8-Oxo-8-(phenylamino)octanoic acid - Names and Identifiers
Name | 7-Phenylcarbamoylheptanoic acid
|
Synonyms | 8-Oxo-8-(phenylamino) 8-anilino-8-oxooctanoic acid 7-Phenylcarbamoylheptanoic acid 7-PHENYLCARBAMOYL-HEPTANOIC ACID 8-Oxo-8-(phenylamino)octanoic acid Octanoic acid,8-oxo-8-(phenylamino)-
|
CAS | 149648-52-2
|
InChI | InChI=1/C14H19NO3/c16-13(15-12-8-4-3-5-9-12)10-6-1-2-7-11-14(17)18/h3-5,8-9H,1-2,6-7,10-11H2,(H,15,16)(H,17,18) |
8-Oxo-8-(phenylamino)octanoic acid - Physico-chemical Properties
Molecular Formula | C14H19NO3
|
Molar Mass | 249.31 |
Density | 1.153 |
Melting Point | 123°C |
Boling Point | 488.6±28.0 °C(Predicted) |
Flash Point | 249.27°C |
Vapor Presure | 0mmHg at 25°C |
pKa | 4.78±0.10(Predicted) |
Storage Condition | Refrigerator |
Refractive Index | 1.56 |
8-Oxo-8-(phenylamino)octanoic acid - Introduction
acid is an organic compound with the chemical formula C13H19NO3. Its nature is as follows:
1. Appearance: acid is a white to light yellow crystalline solid.
2. Solubility: It is soluble in organic solvents such as alcohols and esters, slightly soluble in ether and petroleum ether, insoluble in water.
3. Melting point: Its melting point is in the range of 150-153 degrees Celsius.
4. Stability: Stable at room temperature, but avoid exposure to sunlight and high temperature conditions.
acid has important uses in organic synthesis, and is often used as a crosslinking agent, an efficient curing agent and a catalyst. It can be used as a raw material for synthesizing polymer materials such as polyamide resin, polyurethane and polyimide.
The method for preparing the phenol acid is generally obtained by condensation reaction of 1,6-hexanediamine (or 1,6-hexanediamine) and benzeneformaldehyde. Specific synthetic methods can be carried out using hydrazides or condensing agents such as acetaldehyde and Ammonium iodide. During the synthesis process, attention should be paid to the control of operating temperature and reaction time.
Regarding safety information, acid is a chemical that has certain risks and hazards. Appropriate protective equipment such as lab gloves, goggles and lab coats should be worn during operation. Avoid contact with skin and eyes, and pay attention to protective measures to avoid inhaling dust or gas. Avoid fire and high temperatures during storage and handling. In case of accidental inhalation or contact, seek medical attention immediately.
Last Update:2024-04-10 22:29:15